About 4-tert-butyl-1,1-dimethoxycyclohexane
4-tert-butyl-1,1-dimethoxycyclohexane (PubChem CID 10921547) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dimethoxycyclohexane.
Molecular Properties
| Compound Name | 4-tert-butyl-1,1-dimethoxycyclohexane |
| PubChem CID | 10921547 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 4-tert-butyl-1,1-dimethoxycyclohexane |
| SMILES | COC1(OC)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24O2/c1-11(2,3)10-6-8-12(13-4,14-5)9-7-10/h10H,6-9H2,1-5H3 |
| InChIKey | MYWHEWYKUYIXJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,1-dimethoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,1-dimethoxycyclohexane?
The IUPAC name of 4-tert-butyl-1,1-dimethoxycyclohexane (CID 10921547) is 4-tert-butyl-1,1-dimethoxycyclohexane.
What is the SMILES notation for 4-tert-butyl-1,1-dimethoxycyclohexane?
The canonical SMILES for 4-tert-butyl-1,1-dimethoxycyclohexane is COC1(OC)CCC(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-1,1-dimethoxycyclohexane?
The InChIKey is MYWHEWYKUYIXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-11(2,3)10-6-8-12(13-4,14-5)9-7-10/h10H,6-9H2,1-5H3.
What are the key properties of 4-tert-butyl-1,1-dimethoxycyclohexane?
4-tert-butyl-1,1-dimethoxycyclohexane has a molecular weight of 200.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,1-dimethoxycyclohexane is sourced from PubChem (CID 10921547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).