C12H24O4 — CID 11064300
4-tert-butyl-1,1-bis(methylperoxy)cyclohexane (PubChem CID 11064300) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4-tert-butyl-1,1-bis(methylperoxy)cyclohexane.
| Compound Name | 4-tert-butyl-1,1-bis(methylperoxy)cyclohexane |
|---|---|
| PubChem CID | 11064300 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4-tert-butyl-1,1-bis(methylperoxy)cyclohexane |
| SMILES | COOC1(OOC)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24O4/c1-11(2,3)10-6-8-12(9-7-10,15-13-4)16-14-5/h10H,6-9H2,1-5H3 |
| InChIKey | WCDZOIRGIRPDLF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|