C12H21NO2 — CID 10921786
(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dien-1-ol (PubChem CID 10921786) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dien-1-ol.
| Compound Name | (2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10921786 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dien-1-ol |
| SMILES | C=C(/C(C)=C/CO)N1CCC[C@H]1COC |
| InChI | InChI=1S/C12H21NO2/c1-10(6-8-14)11(2)13-7-4-5-12(13)9-15-3/h6,12,14H,2,4-5,7-9H2,1,3H3/b10-6+/t12-/m0/s1 |
| InChIKey | RILDLJZHOGZYTO-JXPAYYINSA-N |
| XLogP | 1.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|