C15H29NO2Si — CID 10957001
[(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-trimethylsilane (PubChem CID 10957001) has the molecular formula C15H29NO2Si and a molecular weight of 283.49 g/mol. Its IUPAC name is [(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-trimethylsilane.
| Compound Name | [(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10957001 |
| Molecular Formula | C15H29NO2Si |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | [(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-trimethylsilane |
| SMILES | C=C(/C(C)=C/CO[Si](C)(C)C)N1CCC[C@H]1COC |
| InChI | InChI=1S/C15H29NO2Si/c1-13(9-11-18-19(4,5)6)14(2)16-10-7-8-15(16)12-17-3/h9,15H,2,7-8,10-12H2,1,3-6H3/b13-9+/t15-/m0/s1 |
| InChIKey | VGYWTNRMJSMSGP-GLNPCMGASA-N |
| XLogP | 3.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|