C18H35NO2Si — CID 10969423
tert-butyl-[(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-dimethylsilane (PubChem CID 10969423) has the molecular formula C18H35NO2Si and a molecular weight of 325.57 g/mol. Its IUPAC name is tert-butyl-[(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10969423 |
| Molecular Formula | C18H35NO2Si |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl-[(2E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methylpenta-2,4-dienoxy]-dimethylsilane |
| SMILES | C=C(/C(C)=C/CO[Si](C)(C)C(C)(C)C)N1CCC[C@H]1COC |
| InChI | InChI=1S/C18H35NO2Si/c1-15(11-13-21-22(7,8)18(3,4)5)16(2)19-12-9-10-17(19)14-20-6/h11,17H,2,9-10,12-14H2,1,3-8H3/b15-11+/t17-/m0/s1 |
| InChIKey | HOKCYZKETFYDGS-JMPLCFMRSA-N |
| XLogP | 4.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|