C26H41ClN2O4Si — CID 11799820
tert-butyl-[(2Z,4E,6R)-6-(2-chlorophenyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methyl-7-nitrohepta-2,4-dienoxy]-dimethylsilane (PubChem CID 11799820) has the molecular formula C26H41ClN2O4Si and a molecular weight of 509.16 g/mol. Its IUPAC name is tert-butyl-[(2Z,4E,6R)-6-(2-chlorophenyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methyl-7-nitrohepta-2,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z,4E,6R)-6-(2-chlorophenyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methyl-7-nitrohepta-2,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11799820 |
| Molecular Formula | C26H41ClN2O4Si |
| Molecular Weight | 509.16 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | tert-butyl-[(2Z,4E,6R)-6-(2-chlorophenyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-methyl-7-nitrohepta-2,4-dienoxy]-dimethylsilane |
| SMILES | COC[C@@H]1CCCN1C(=C/[C@@H](C[N+](=O)[O-])c1ccccc1Cl)/C(C)=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H41ClN2O4Si/c1-20(14-16-33-34(6,7)26(2,3)4)25(28-15-10-11-22(28)19-32-5)17-21(18-29(30)31)23-12-8-9-13-24(23)27/h8-9,12-14,17,21-22H,10-11,15-16,18-19H2,1-7H3/b20-14-,25-17+/t21-,22-/m0/s1 |
| InChIKey | PUKAPHUGXILMPA-PBWDXSFMSA-N |
| XLogP | 6.66 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.16 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|