C16H17ClN2O2 — CID 50963476
(8-chloroquinolin-2-yl)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 50963476) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is (8-chloroquinolin-2-yl)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (8-chloroquinolin-2-yl)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 50963476 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (8-chloroquinolin-2-yl)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COC[C@@H]1CCCN1C(=O)c1ccc2cccc(Cl)c2n1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-21-10-12-5-3-9-19(12)16(20)14-8-7-11-4-2-6-13(17)15(11)18-14/h2,4,6-8,12H,3,5,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | YDZLHTJOODGHOB-LBPRGKRZSA-N |
| XLogP | 3.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |