C21H39NO4Si — CID 177449009
methyl (Z)-3-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-4-(2-methylbut-3-en-2-yloxy)but-2-enoate (PubChem CID 177449009) has the molecular formula C21H39NO4Si and a molecular weight of 397.63 g/mol. Its IUPAC name is methyl (Z)-3-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-4-(2-methylbut-3-en-2-yloxy)but-2-enoate.
| Compound Name | methyl (Z)-3-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-4-(2-methylbut-3-en-2-yloxy)but-2-enoate |
|---|---|
| PubChem CID | 177449009 |
| Molecular Formula | C21H39NO4Si |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | methyl (Z)-3-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-4-(2-methylbut-3-en-2-yloxy)but-2-enoate |
| SMILES | C=CC(C)(C)OC/C(=C/C(=O)OC)N1CCC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39NO4Si/c1-10-21(5,6)25-15-18(14-19(23)24-7)22-13-11-12-17(22)16-26-27(8,9)20(2,3)4/h10,14,17H,1,11-13,15-16H2,2-9H3/b18-14-/t17-/m0/s1 |
| InChIKey | NEWBIPYGVUCUBC-SKQHNDAPSA-N |
| XLogP | 4.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|