C20H40N2O4Si — CID 10811019
(E,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-1,3-dioxan-5-imine (PubChem CID 10811019) has the molecular formula C20H40N2O4Si and a molecular weight of 400.64 g/mol. Its IUPAC name is (E,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-1,3-dioxan-5-imine.
| Compound Name | (E,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 10811019 |
| Molecular Formula | C20H40N2O4Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (E,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-1,3-dioxan-5-imine |
| SMILES | COC[C@H]1CCCN1/N=C1\COC(C)(C)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40N2O4Si/c1-19(2,3)27(7,8)25-13-11-18-17(15-24-20(4,5)26-18)21-22-12-9-10-16(22)14-23-6/h16,18H,9-15H2,1-8H3/b21-17+/t16-,18-/m1/s1 |
| InChIKey | DYCCXNYWGPRLJU-MPUUSSKYSA-N |
| XLogP | 4.02 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|