C22H23N3O2 — CID 109219903
4-(3,4-dimethylanilino)-N-(4-ethoxyphenyl)pyridine-2-carboxamide (PubChem CID 109219903) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-(3,4-dimethylanilino)-N-(4-ethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(3,4-dimethylanilino)-N-(4-ethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109219903 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-(3,4-dimethylanilino)-N-(4-ethoxyphenyl)pyridine-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(Nc3ccc(C)c(C)c3)ccn2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-4-27-20-9-7-17(8-10-20)25-22(26)21-14-19(11-12-23-21)24-18-6-5-15(2)16(3)13-18/h5-14H,4H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | JEDMWFBWGMGJEQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |