C21H16F3N3O — CID 109222608
(2-methyl-2,3-dihydroindol-1-yl)-[4-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone (PubChem CID 109222608) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is (2-methyl-2,3-dihydroindol-1-yl)-[4-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone.
| Compound Name | (2-methyl-2,3-dihydroindol-1-yl)-[4-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109222608 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2-methyl-2,3-dihydroindol-1-yl)-[4-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone |
| SMILES | CC1Cc2ccccc2N1C(=O)c1cc(Nc2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C21H16F3N3O/c1-12-10-13-4-2-3-5-18(13)27(12)21(28)17-11-14(8-9-25-17)26-16-7-6-15(22)19(23)20(16)24/h2-9,11-12H,10H2,1H3,(H,25,26) |
| InChIKey | JJRBVDQKBMBTCC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|