C20H25N3O3 — CID 109226939
5-(cyclohexylamino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109226939) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-(cyclohexylamino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(cyclohexylamino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226939 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 5-(cyclohexylamino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cncc(NC3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-25-17-8-9-18(19(11-17)26-2)23-20(24)14-10-16(13-21-12-14)22-15-6-4-3-5-7-15/h8-13,15,22H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | MFWPZLQRYRJMTA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |