C20H24ClN3O3 — CID 109226984
N-(4-chloro-2,5-dimethoxyphenyl)-5-(cyclohexylamino)pyridine-3-carboxamide (PubChem CID 109226984) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-5-(cyclohexylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(cyclohexylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226984 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(cyclohexylamino)pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cncc(NC3CCCCC3)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3/c1-26-18-10-17(19(27-2)9-16(18)21)24-20(25)13-8-15(12-22-11-13)23-14-6-4-3-5-7-14/h8-12,14,23H,3-7H2,1-2H3,(H,24,25) |
| InChIKey | QCPJRDPPCXTSAH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |