C18H30N4O — CID 109229945
N-cycloheptyl-5-[3-(dimethylamino)propylamino]pyridine-3-carboxamide (PubChem CID 109229945) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is N-cycloheptyl-5-[3-(dimethylamino)propylamino]pyridine-3-carboxamide.
| Compound Name | N-cycloheptyl-5-[3-(dimethylamino)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229945 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-cycloheptyl-5-[3-(dimethylamino)propylamino]pyridine-3-carboxamide |
| SMILES | CN(C)CCCNc1cncc(C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C18H30N4O/c1-22(2)11-7-10-20-17-12-15(13-19-14-17)18(23)21-16-8-5-3-4-6-9-16/h12-14,16,20H,3-11H2,1-2H3,(H,21,23) |
| InChIKey | GKFWZQBPTZABBW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|