C20H28N4O2 — CID 109230003
5-[3-(dimethylamino)propylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide (PubChem CID 109230003) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-[3-(dimethylamino)propylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109230003 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 5-[3-(dimethylamino)propylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cncc(NCCCN(C)C)c1 |
| InChI | InChI=1S/C20H28N4O2/c1-15(2)26-19-9-6-5-8-18(19)23-20(25)16-12-17(14-21-13-16)22-10-7-11-24(3)4/h5-6,8-9,12-15,22H,7,10-11H2,1-4H3,(H,23,25) |
| InChIKey | VNHNPFIZKBWVFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|