C23H29N3O2 — CID 109227594
5-[2-(cyclohexen-1-yl)ethylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide (PubChem CID 109227594) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227594 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cncc(NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-17(2)28-22-11-7-6-10-21(22)26-23(27)19-14-20(16-24-15-19)25-13-12-18-8-4-3-5-9-18/h6-8,10-11,14-17,25H,3-5,9,12-13H2,1-2H3,(H,26,27) |
| InChIKey | WMSLURZQGGYRHR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|