C19H26N2O3 — CID 108984196
N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-propan-2-yloxyphenyl)oxamide (PubChem CID 108984196) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-propan-2-yloxyphenyl)oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-propan-2-yloxyphenyl)oxamide |
|---|---|
| PubChem CID | 108984196 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-propan-2-yloxyphenyl)oxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H26N2O3/c1-14(2)24-17-11-7-6-10-16(17)21-19(23)18(22)20-13-12-15-8-4-3-5-9-15/h6-8,10-11,14H,3-5,9,12-13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VKPFARZFBRCKJX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|