C22H33N3O2 — CID 113104743
4-[2-(cyclohexen-1-yl)ethyl]-N-(2-propan-2-yloxyphenyl)piperazine-1-carboxamide (PubChem CID 113104743) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethyl]-N-(2-propan-2-yloxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethyl]-N-(2-propan-2-yloxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113104743 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethyl]-N-(2-propan-2-yloxyphenyl)piperazine-1-carboxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)N1CCN(CCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-18(2)27-21-11-7-6-10-20(21)23-22(26)25-16-14-24(15-17-25)13-12-19-8-4-3-5-9-19/h6-8,10-11,18H,3-5,9,12-17H2,1-2H3,(H,23,26) |
| InChIKey | XOZRBRDTTXARTE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|