C21H22F3N3O — CID 109227601
5-[2-(cyclohexen-1-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 109227601) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227601 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cncc(NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C21H22F3N3O/c22-21(23,24)17-6-8-18(9-7-17)27-20(28)16-12-19(14-25-13-16)26-11-10-15-4-2-1-3-5-15/h4,6-9,12-14,26H,1-3,5,10-11H2,(H,27,28) |
| InChIKey | NYQCDZROZAUUBP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|