C20H21Cl2N3O — CID 109227622
5-[2-(cyclohexen-1-yl)ethylamino]-N-(3,5-dichlorophenyl)pyridine-3-carboxamide (PubChem CID 109227622) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylamino]-N-(3,5-dichlorophenyl)pyridine-3-carboxamide.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(3,5-dichlorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227622 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(3,5-dichlorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cncc(NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C20H21Cl2N3O/c21-16-9-17(22)11-18(10-16)25-20(26)15-8-19(13-23-12-15)24-7-6-14-4-2-1-3-5-14/h4,8-13,24H,1-3,5-7H2,(H,25,26) |
| InChIKey | MHKSKJHFSXFNHI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|