C13H16O5 — CID 10923004
[(3aS,5S,7aS)-3-acetyl-2-methyl-5,7a-dihydro-3aH-furo[3,2-b]pyran-5-yl]methyl acetate (PubChem CID 10923004) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(3aS,5S,7aS)-3-acetyl-2-methyl-5,7a-dihydro-3aH-furo[3,2-b]pyran-5-yl]methyl acetate.
| Compound Name | [(3aS,5S,7aS)-3-acetyl-2-methyl-5,7a-dihydro-3aH-furo[3,2-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 10923004 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(3aS,5S,7aS)-3-acetyl-2-methyl-5,7a-dihydro-3aH-furo[3,2-b]pyran-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@@H]2OC(C)=C(C(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H16O5/c1-7(14)12-8(2)17-11-5-4-10(18-13(11)12)6-16-9(3)15/h4-5,10-11,13H,6H2,1-3H3/t10-,11-,13+/m0/s1 |
| InChIKey | MVSXEQQWNQONTA-GMXVVIOVSA-N |
| XLogP | 1.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|