C17H19N5O2 — CID 109230884
5-(4-formylpiperazin-1-yl)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 109230884) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-(4-formylpiperazin-1-yl)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-formylpiperazin-1-yl)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109230884 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 5-(4-formylpiperazin-1-yl)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=CN1CCN(c2cncc(C(=O)NCc3cccnc3)c2)CC1 |
| InChI | InChI=1S/C17H19N5O2/c23-13-21-4-6-22(7-5-21)16-8-15(11-19-12-16)17(24)20-10-14-2-1-3-18-9-14/h1-3,8-9,11-13H,4-7,10H2,(H,20,24) |
| InChIKey | FSMUGNZSGAKEGI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|