C22H22FN5O — CID 109233560
N-[(4-fluorophenyl)methyl]-5-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 109233560) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109233560 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cncc(N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C22H22FN5O/c23-19-6-4-17(5-7-19)14-26-22(29)18-13-20(16-24-15-18)27-9-11-28(12-10-27)21-3-1-2-8-25-21/h1-8,13,15-16H,9-12,14H2,(H,26,29) |
| InChIKey | BPWSSNWUVHVDNC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |