About 2-tetradeca-4,9-diynylpropanedinitrile
2-tetradeca-4,9-diynylpropanedinitrile (PubChem CID 10923092) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-tetradeca-4,9-diynylpropanedinitrile.
Molecular Properties
| Compound Name | 2-tetradeca-4,9-diynylpropanedinitrile |
| PubChem CID | 10923092 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-tetradeca-4,9-diynylpropanedinitrile |
| SMILES | CCCCC#CCCCC#CCCCC(C#N)C#N |
| InChI | InChI=1S/C17H22N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(15-18)16-19/h17H,2-4,7-9,12-14H2,1H3 |
| InChIKey | IOWIWXFEUZQSCE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-tetradeca-4,9-diynylpropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tetradeca-4,9-diynylpropanedinitrile?
The IUPAC name of 2-tetradeca-4,9-diynylpropanedinitrile (CID 10923092) is 2-tetradeca-4,9-diynylpropanedinitrile.
What is the SMILES notation for 2-tetradeca-4,9-diynylpropanedinitrile?
The canonical SMILES for 2-tetradeca-4,9-diynylpropanedinitrile is CCCCC#CCCCC#CCCCC(C#N)C#N.
What is the InChIKey of 2-tetradeca-4,9-diynylpropanedinitrile?
The InChIKey is IOWIWXFEUZQSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(15-18)16-19/h17H,2-4,7-9,12-14H2,1H3.
What are the key properties of 2-tetradeca-4,9-diynylpropanedinitrile?
2-tetradeca-4,9-diynylpropanedinitrile has a molecular weight of 254.38 g/mol, XLogP of 4.19, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tetradeca-4,9-diynylpropanedinitrile is sourced from PubChem (CID 10923092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).