About 1,3-dithiole;2-pentylpropanedinitrile
1,3-dithiole;2-pentylpropanedinitrile (PubChem CID 175516708) has the molecular formula C11H16N2S2
and a molecular weight of 240.40 g/mol. Its IUPAC name is 1,3-dithiole;2-pentylpropanedinitrile.
Molecular Properties
| Compound Name | 1,3-dithiole;2-pentylpropanedinitrile |
| PubChem CID | 175516708 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1,3-dithiole;2-pentylpropanedinitrile |
| SMILES | C1=CSCS1.CCCCCC(C#N)C#N |
| InChI | InChI=1S/C8H12N2.C3H4S2/c1-2-3-4-5-8(6-9)7-10;1-2-5-3-4-1/h8H,2-5H2,1H3;1-2H,3H2 |
| InChIKey | QTCBXIBBRIEHFE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dithiole;2-pentylpropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dithiole;2-pentylpropanedinitrile?
The IUPAC name of 1,3-dithiole;2-pentylpropanedinitrile (CID 175516708) is 1,3-dithiole;2-pentylpropanedinitrile.
What is the SMILES notation for 1,3-dithiole;2-pentylpropanedinitrile?
The canonical SMILES for 1,3-dithiole;2-pentylpropanedinitrile is C1=CSCS1.CCCCCC(C#N)C#N.
What is the InChIKey of 1,3-dithiole;2-pentylpropanedinitrile?
The InChIKey is QTCBXIBBRIEHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C3H4S2/c1-2-3-4-5-8(6-9)7-10;1-2-5-3-4-1/h8H,2-5H2,1H3;1-2H,3H2.
What are the key properties of 1,3-dithiole;2-pentylpropanedinitrile?
1,3-dithiole;2-pentylpropanedinitrile has a molecular weight of 240.40 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dithiole;2-pentylpropanedinitrile is sourced from PubChem (CID 175516708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).