C15H13NO3 — CID 10923106
4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)naphthalene-1,2-dione (PubChem CID 10923106) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)naphthalene-1,2-dione.
| Compound Name | 4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 10923106 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)naphthalene-1,2-dione |
| SMILES | CC1(C)COC(C2=CC(=O)C(=O)c3ccccc32)=N1 |
| InChI | InChI=1S/C15H13NO3/c1-15(2)8-19-14(16-15)11-7-12(17)13(18)10-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3 |
| InChIKey | PONLIRUDMVTPTR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|