C18H17NO2 — CID 70884173
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone (PubChem CID 70884173) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone.
| Compound Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 70884173 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-phenylmethanone |
| SMILES | CC1(C)COC(c2ccc(C(=O)c3ccccc3)cc2)=N1 |
| InChI | InChI=1S/C18H17NO2/c1-18(2)12-21-17(19-18)15-10-8-14(9-11-15)16(20)13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | XEXAQTASGUKANI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |