C20H16N4O2 — CID 109231433
N-(furan-2-ylmethyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide (PubChem CID 109231433) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109231433 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-(quinolin-8-ylamino)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cncc(Nc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C20H16N4O2/c25-20(23-13-17-6-3-9-26-17)15-10-16(12-21-11-15)24-18-7-1-4-14-5-2-8-22-19(14)18/h1-12,24H,13H2,(H,23,25) |
| InChIKey | ZYCFGMDAZHNHNN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |