C15H20O4 — CID 10923410
ethyl 2-[(1S,2R,3S,6R,7S,8R)-3,6-dihydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]acetate (PubChem CID 10923410) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,3S,6R,7S,8R)-3,6-dihydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,3S,6R,7S,8R)-3,6-dihydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]acetate |
|---|---|
| PubChem CID | 10923410 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl 2-[(1S,2R,3S,6R,7S,8R)-3,6-dihydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]acetate |
| SMILES | CCOC(=O)C[C@]1(O)C=C[C@@H](O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H20O4/c1-2-19-12(17)8-15(18)6-5-11(16)13-9-3-4-10(7-9)14(13)15/h3-6,9-11,13-14,16,18H,2,7-8H2,1H3/t9-,10+,11+,13+,14+,15+/m0/s1 |
| InChIKey | ZKHMXDVEUVMRBP-MRIXOBAXSA-N |
| XLogP | 1.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|