C21H19ClFN3O — CID 109236280
5-(4-chloro-2-methylanilino)-N-[2-(2-fluorophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 109236280) has the molecular formula C21H19ClFN3O and a molecular weight of 383.85 g/mol. Its IUPAC name is 5-(4-chloro-2-methylanilino)-N-[2-(2-fluorophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-(4-chloro-2-methylanilino)-N-[2-(2-fluorophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109236280 |
| Molecular Formula | C21H19ClFN3O |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 5-(4-chloro-2-methylanilino)-N-[2-(2-fluorophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Nc1cncc(C(=O)NCCc2ccccc2F)c1 |
| InChI | InChI=1S/C21H19ClFN3O/c1-14-10-17(22)6-7-20(14)26-18-11-16(12-24-13-18)21(27)25-9-8-15-4-2-3-5-19(15)23/h2-7,10-13,26H,8-9H2,1H3,(H,25,27) |
| InChIKey | SLFAWIIRDWCFRH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |