C20H19FN4O — CID 109237107
N-(4-fluorophenyl)-5-[methyl(2-pyridin-4-ylethyl)amino]pyridine-3-carboxamide (PubChem CID 109237107) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[methyl(2-pyridin-4-ylethyl)amino]pyridine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-[methyl(2-pyridin-4-ylethyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237107 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-(4-fluorophenyl)-5-[methyl(2-pyridin-4-ylethyl)amino]pyridine-3-carboxamide |
| SMILES | CN(CCc1ccncc1)c1cncc(C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN4O/c1-25(11-8-15-6-9-22-10-7-15)19-12-16(13-23-14-19)20(26)24-18-4-2-17(21)3-5-18/h2-7,9-10,12-14H,8,11H2,1H3,(H,24,26) |
| InChIKey | NCGKGMLNQVWPSL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |