C23H25N3O — CID 112983707
3,4-dimethyl-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide (PubChem CID 112983707) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 112983707 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3,4-dimethyl-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N(C)CCc3ccncc3)cc2)cc1C |
| InChI | InChI=1S/C23H25N3O/c1-17-4-5-20(16-18(17)2)23(27)25-21-6-8-22(9-7-21)26(3)15-12-19-10-13-24-14-11-19/h4-11,13-14,16H,12,15H2,1-3H3,(H,25,27) |
| InChIKey | AZMVDUVQVLPLAQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|