C21H19ClFN3O — CID 112983725
2-chloro-6-fluoro-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide (PubChem CID 112983725) has the molecular formula C21H19ClFN3O and a molecular weight of 383.85 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 112983725 |
| Molecular Formula | C21H19ClFN3O |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-chloro-6-fluoro-N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzamide |
| SMILES | CN(CCc1ccncc1)c1ccc(NC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C21H19ClFN3O/c1-26(14-11-15-9-12-24-13-10-15)17-7-5-16(6-8-17)25-21(27)20-18(22)3-2-4-19(20)23/h2-10,12-13H,11,14H2,1H3,(H,25,27) |
| InChIKey | VRQWEFQYSQNRPD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|