C16H23N3O3S — CID 109237170
5-(azepan-1-yl)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 109237170) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 5-(azepan-1-yl)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 5-(azepan-1-yl)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237170 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-(azepan-1-yl)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cncc(N2CCCCCC2)c1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16(18-14-5-8-23(21,22)12-14)13-9-15(11-17-10-13)19-6-3-1-2-4-7-19/h9-11,14H,1-8,12H2,(H,18,20) |
| InChIKey | DMYQMLVKNAZWMH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |