About Dihexyl(phenyl)silane
Dihexyl(phenyl)silane (PubChem CID 10923838) has the molecular formula C18H31Si
and a molecular weight of 275.53 g/mol.
Molecular Properties
| Compound Name | Dihexyl(phenyl)silane |
| PubChem CID | 10923838 |
| Molecular Formula | C18H31Si |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | — |
| SMILES | CCCCCC[Si](CCCCCC)c1ccccc1 |
| InChI | InChI=1S/C18H31Si/c1-3-5-7-12-16-19(17-13-8-6-4-2)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | XWAMNXFZWZHSJN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Dihexyl(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dihexyl(phenyl)silane?
The IUPAC name of Dihexyl(phenyl)silane (CID 10923838) is not available.
What is the SMILES notation for Dihexyl(phenyl)silane?
The canonical SMILES for Dihexyl(phenyl)silane is CCCCCC[Si](CCCCCC)c1ccccc1.
What is the InChIKey of Dihexyl(phenyl)silane?
The InChIKey is XWAMNXFZWZHSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31Si/c1-3-5-7-12-16-19(17-13-8-6-4-2)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3.
What are the key properties of Dihexyl(phenyl)silane?
Dihexyl(phenyl)silane has a molecular weight of 275.53 g/mol, XLogP of 5.55, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dihexyl(phenyl)silane is sourced from PubChem (CID 10923838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).