C20H25ClN4O — CID 109238491
5-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridine-3-carboxamide (PubChem CID 109238491) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridine-3-carboxamide.
| Compound Name | 5-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109238491 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[4-(3-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(N2CCN(c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C20H25ClN4O/c1-3-23(4-2)20(26)16-12-19(15-22-14-16)25-10-8-24(9-11-25)18-7-5-6-17(21)13-18/h5-7,12-15H,3-4,8-11H2,1-2H3 |
| InChIKey | RKQGWTDSWFQWHB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |