C19H24N4O3 — CID 109238550
[4-[5-(diethylamino)pyridine-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 109238550) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is [4-[5-(diethylamino)pyridine-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[5-(diethylamino)pyridine-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 109238550 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [4-[5-(diethylamino)pyridine-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCN(CC)c1cncc(C(=O)N2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-21(4-2)16-12-15(13-20-14-16)18(24)22-7-9-23(10-8-22)19(25)17-6-5-11-26-17/h5-6,11-14H,3-4,7-10H2,1-2H3 |
| InChIKey | CMOPPFCMFHJJMX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |