C18H23N5O3 — CID 109310510
[2-(diethylamino)pyrimidin-4-yl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 109310510) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-(diethylamino)pyrimidin-4-yl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [2-(diethylamino)pyrimidin-4-yl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109310510 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [2-(diethylamino)pyrimidin-4-yl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | CCN(CC)c1nccc(C(=O)N2CCN(C(=O)c3ccco3)CC2)n1 |
| InChI | InChI=1S/C18H23N5O3/c1-3-21(4-2)18-19-8-7-14(20-18)16(24)22-9-11-23(12-10-22)17(25)15-6-5-13-26-15/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | AADXTESUPIWWLA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |