C20H25N3O — CID 109241222
azepan-1-yl-[5-(2,5-dimethylanilino)-3-pyridinyl]methanone (PubChem CID 109241222) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is azepan-1-yl-[5-(2,5-dimethylanilino)-3-pyridinyl]methanone.
| Compound Name | azepan-1-yl-[5-(2,5-dimethylanilino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109241222 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | azepan-1-yl-[5-(2,5-dimethylanilino)-3-pyridinyl]methanone |
| SMILES | Cc1ccc(C)c(Nc2cncc(C(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-15-7-8-16(2)19(11-15)22-18-12-17(13-21-14-18)20(24)23-9-5-3-4-6-10-23/h7-8,11-14,22H,3-6,9-10H2,1-2H3 |
| InChIKey | VBPVJMQHLNVQLG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |