C14H19NO4S — CID 10924471
tert-butyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 10924471) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is tert-butyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10924471 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | tert-butyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-5-7-11(8-6-10)20(17,18)15-9-12(15)13(16)19-14(2,3)4/h5-8,12H,9H2,1-4H3/t12-,15?/m0/s1 |
| InChIKey | PTJUKGHBZRTRGC-SFVWDYPZSA-N |
| XLogP | 1.71 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|