C18H22O2Si — CID 10924517
1,3-diphenyl-3-trimethylsilyloxypropan-1-one (PubChem CID 10924517) has the molecular formula C18H22O2Si and a molecular weight of 298.46 g/mol. Its IUPAC name is 1,3-diphenyl-3-trimethylsilyloxypropan-1-one.
| Compound Name | 1,3-diphenyl-3-trimethylsilyloxypropan-1-one |
|---|---|
| PubChem CID | 10924517 |
| Molecular Formula | C18H22O2Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1,3-diphenyl-3-trimethylsilyloxypropan-1-one |
| SMILES | C[Si](C)(C)OC(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22O2Si/c1-21(2,3)20-18(16-12-8-5-9-13-16)14-17(19)15-10-6-4-7-11-15/h4-13,18H,14H2,1-3H3 |
| InChIKey | QMLAIVCZGZLUNL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|