C19H15Cl2N3O2 — CID 109245369
N-(2,4-dichlorophenyl)-5-(4-methoxyanilino)pyridine-3-carboxamide (PubChem CID 109245369) has the molecular formula C19H15Cl2N3O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-(4-methoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-5-(4-methoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109245369 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-(4-methoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2cncc(C(=O)Nc3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c1-26-16-5-3-14(4-6-16)23-15-8-12(10-22-11-15)19(25)24-18-7-2-13(20)9-17(18)21/h2-11,23H,1H3,(H,24,25) |
| InChIKey | URGRZCSSMCJJQL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |