C13H12N2O3 — CID 82535078
5-(4-methoxyanilino)pyridine-3-carboxylic acid (PubChem CID 82535078) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-(4-methoxyanilino)pyridine-3-carboxylic acid.
| Compound Name | 5-(4-methoxyanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82535078 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(4-methoxyanilino)pyridine-3-carboxylic acid |
| SMILES | COc1ccc(Nc2cncc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H12N2O3/c1-18-12-4-2-10(3-5-12)15-11-6-9(13(16)17)7-14-8-11/h2-8,15H,1H3,(H,16,17) |
| InChIKey | MRISSIPMKHKJNV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |