C17H20O5 — CID 10924727
(4'aS,5'S,8'aR,9'aR,10'aR)-5'-methoxyspiro[1,3-dioxolane-2,9'-4a,5,8,8a,9a,10a-hexahydro-1H-anthracene]-2',10'-dione (PubChem CID 10924727) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (4'aS,5'S,8'aR,9'aR,10'aR)-5'-methoxyspiro[1,3-dioxolane-2,9'-4a,5,8,8a,9a,10a-hexahydro-1H-anthracene]-2',10'-dione.
| Compound Name | (4'aS,5'S,8'aR,9'aR,10'aR)-5'-methoxyspiro[1,3-dioxolane-2,9'-4a,5,8,8a,9a,10a-hexahydro-1H-anthracene]-2',10'-dione |
|---|---|
| PubChem CID | 10924727 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (4'aS,5'S,8'aR,9'aR,10'aR)-5'-methoxyspiro[1,3-dioxolane-2,9'-4a,5,8,8a,9a,10a-hexahydro-1H-anthracene]-2',10'-dione |
| SMILES | CO[C@H]1C=CC[C@@H]2[C@H]1C(=O)[C@H]1C=CC(=O)C[C@H]1C21OCCO1 |
| InChI | InChI=1S/C17H20O5/c1-20-14-4-2-3-12-15(14)16(19)11-6-5-10(18)9-13(11)17(12)21-7-8-22-17/h2,4-6,11-15H,3,7-9H2,1H3/t11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | KKQTYNHKWWZTNR-VYDRJRHOSA-N |
| XLogP | 1.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|