C18H22O5 — CID 11088427
(2R,6aS,10aS,10bS)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,10a,10b-hexahydro-2H-benzo[h]chromene-7,10-dione (PubChem CID 11088427) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R,6aS,10aS,10bS)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,10a,10b-hexahydro-2H-benzo[h]chromene-7,10-dione.
| Compound Name | (2R,6aS,10aS,10bS)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,10a,10b-hexahydro-2H-benzo[h]chromene-7,10-dione |
|---|---|
| PubChem CID | 11088427 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (2R,6aS,10aS,10bS)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,10a,10b-hexahydro-2H-benzo[h]chromene-7,10-dione |
| SMILES | CC1(C)OC[C@H]([C@H]2CCC3=CC[C@@H]4C(=O)C=CC(=O)[C@@H]4[C@@H]3O2)O1 |
| InChI | InChI=1S/C18H22O5/c1-18(2)21-9-15(23-18)14-8-4-10-3-5-11-12(19)6-7-13(20)16(11)17(10)22-14/h3,6-7,11,14-17H,4-5,8-9H2,1-2H3/t11-,14-,15-,16-,17-/m1/s1 |
| InChIKey | QCWWWXPJQQLTHL-JSPVNYKOSA-N |
| XLogP | 1.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|