C16H20O6 — CID 101229757
(2R,6aS,9aS,9bS)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione (PubChem CID 101229757) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2R,6aS,9aS,9bS)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione.
| Compound Name | (2R,6aS,9aS,9bS)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione |
|---|---|
| PubChem CID | 101229757 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2R,6aS,9aS,9bS)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione |
| SMILES | CC1(C)OC[C@@H]([C@H]2CCC3=CC[C@@H]4C(=O)OC(=O)[C@@H]4[C@@H]3O2)O1 |
| InChI | InChI=1S/C16H20O6/c1-16(2)19-7-11(22-16)10-6-4-8-3-5-9-12(13(8)20-10)15(18)21-14(9)17/h3,9-13H,4-7H2,1-2H3/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | GJJJIXQHQNDJRZ-FPYNETTCSA-N |
| XLogP | 1.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|