C23H28O7 — CID 123376598
5-(4,5,6-trimethoxyhepta-1,3,5-trien-2-yl)-5a,8,8a,9,10,10a-hexahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (PubChem CID 123376598) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-(4,5,6-trimethoxyhepta-1,3,5-trien-2-yl)-5a,8,8a,9,10,10a-hexahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one.
| Compound Name | 5-(4,5,6-trimethoxyhepta-1,3,5-trien-2-yl)-5a,8,8a,9,10,10a-hexahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 123376598 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 5-(4,5,6-trimethoxyhepta-1,3,5-trien-2-yl)-5a,8,8a,9,10,10a-hexahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| SMILES | C=C(C=C(OC)C(OC)=C(C)OC)C1C2=C(CC3OCOC3=C2)CC2COC(=O)C21 |
| InChI | InChI=1S/C23H28O7/c1-12(6-19(26-4)22(27-5)13(2)25-3)20-16-9-18-17(29-11-30-18)8-14(16)7-15-10-28-23(24)21(15)20/h6,9,15,17,20-21H,1,7-8,10-11H2,2-5H3 |
| InChIKey | BNHLEWHVUHLJIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|