C16H22O4 — CID 59975412
(1'R,3'aR,9'aS)-1',9'-dimethylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one (PubChem CID 59975412) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1'R,3'aR,9'aS)-1',9'-dimethylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one.
| Compound Name | (1'R,3'aR,9'aS)-1',9'-dimethylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 59975412 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1'R,3'aR,9'aS)-1',9'-dimethylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
| SMILES | CC1C2CCC3(CC2=C[C@H]2C(=O)O[C@H](C)[C@@H]12)OCCO3 |
| InChI | InChI=1S/C16H22O4/c1-9-12-3-4-16(18-5-6-19-16)8-11(12)7-13-14(9)10(2)20-15(13)17/h7,9-10,12-14H,3-6,8H2,1-2H3/t9?,10-,12?,13-,14-/m1/s1 |
| InChIKey | OGGNMQSAKURMBY-VDGZTCLBSA-N |
| XLogP | 2.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|