C16H21FO4 — CID 143261766
(3'aR,9'aS)-1'-(fluoromethyl)-3'a-methylspiro[1,3-dioxolane-2,6'-5,7,8,8a,9,9a-hexahydro-1H-benzo[f][2]benzofuran]-3'-one (PubChem CID 143261766) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is (3'aR,9'aS)-1'-(fluoromethyl)-3'a-methylspiro[1,3-dioxolane-2,6'-5,7,8,8a,9,9a-hexahydro-1H-benzo[f][2]benzofuran]-3'-one.
| Compound Name | (3'aR,9'aS)-1'-(fluoromethyl)-3'a-methylspiro[1,3-dioxolane-2,6'-5,7,8,8a,9,9a-hexahydro-1H-benzo[f][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 143261766 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3'aR,9'aS)-1'-(fluoromethyl)-3'a-methylspiro[1,3-dioxolane-2,6'-5,7,8,8a,9,9a-hexahydro-1H-benzo[f][2]benzofuran]-3'-one |
| SMILES | C[C@@]12C=C3CC4(CCC3C[C@@H]1C(CF)OC2=O)OCCO4 |
| InChI | InChI=1S/C16H21FO4/c1-15-7-11-8-16(19-4-5-20-16)3-2-10(11)6-12(15)13(9-17)21-14(15)18/h7,10,12-13H,2-6,8-9H2,1H3/t10?,12-,13?,15-/m1/s1 |
| InChIKey | XUBMCASFEHGITI-IVYIRIEZSA-N |
| XLogP | 2.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|