C18H26O5 — CID 134889095
(4R,4aR,6R)-4-methyl-6-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3,4,5,6,7-hexahydronaphthalene-2,2'-1,3-dioxolane]-4a-carbaldehyde (PubChem CID 134889095) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (4R,4aR,6R)-4-methyl-6-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3,4,5,6,7-hexahydronaphthalene-2,2'-1,3-dioxolane]-4a-carbaldehyde.
| Compound Name | (4R,4aR,6R)-4-methyl-6-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3,4,5,6,7-hexahydronaphthalene-2,2'-1,3-dioxolane]-4a-carbaldehyde |
|---|---|
| PubChem CID | 134889095 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (4R,4aR,6R)-4-methyl-6-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3,4,5,6,7-hexahydronaphthalene-2,2'-1,3-dioxolane]-4a-carbaldehyde |
| SMILES | C[C@@H]1CC2(CC3=CC[C@@H](C4(C)OCCO4)C[C@]31C=O)OCCO2 |
| InChI | InChI=1S/C18H26O5/c1-13-9-18(22-7-8-23-18)11-15-4-3-14(10-17(13,15)12-19)16(2)20-5-6-21-16/h4,12-14H,3,5-11H2,1-2H3/t13-,14-,17-/m1/s1 |
| InChIKey | VXSGLEJRGCXASG-CKEIUWERSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|